methyl N-[2-(2,5-dichlorothiophen-3-yl)-2-oxoethyl]carbamate

C8H7Cl2NO3S — CID 21283503

IUPACmethyl N-[2-(2,5-dichlorothiophen-3-yl)-2-oxoethyl]carbamate
SMILESCOC(=O)NCC(=O)c1cc(Cl)sc1Cl
InChIInChI=1S/C8H7Cl2NO3S/c1-14-8(13)11-3-5(12)4-2-6(9)15-7(4)10/h2H,3H2,1H3,(H,11,13)
InChIKeyIEUJDXNFZLBZGM-UHFFFAOYSA-N
MW268.12 g/mol
LogP2.59
Rot. Bonds3

About methyl N-[2-(2,5-dichlorothiophen-3-yl)-2-oxoethyl]carbamate

methyl N-[2-(2,5-dichlorothiophen-3-yl)-2-oxoethyl]carbamate (PubChem CID 21283503) has the molecular formula C8H7Cl2NO3S and a molecular weight of 268.12 g/mol. Its IUPAC name is methyl N-[2-(2,5-dichlorothiophen-3-yl)-2-oxoethyl]carbamate.

Molecular Properties

Compound Namemethyl N-[2-(2,5-dichlorothiophen-3-yl)-2-oxoethyl]carbamate
PubChem CID21283503
Molecular FormulaC8H7Cl2NO3S
Molecular Weight268.12 g/mol
Exact Mass266.95
IUPAC Namemethyl N-[2-(2,5-dichlorothiophen-3-yl)-2-oxoethyl]carbamate
SMILESCOC(=O)NCC(=O)c1cc(Cl)sc1Cl
InChIInChI=1S/C8H7Cl2NO3S/c1-14-8(13)11-3-5(12)4-2-6(9)15-7(4)10/h2H,3H2,1H3,(H,11,13)
InChIKeyIEUJDXNFZLBZGM-UHFFFAOYSA-N
XLogP2.59
TPSA55.40 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500268.12
LogP ≤ 52.59
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl N-[2-(2,5-dichlorothiophen-3-yl)-2-oxoethyl]carbamate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl N-[2-(2,5-dichlorothiophen-3-yl)-2-oxoethyl]carbamate?
The IUPAC name of methyl N-[2-(2,5-dichlorothiophen-3-yl)-2-oxoethyl]carbamate (CID 21283503) is methyl N-[2-(2,5-dichlorothiophen-3-yl)-2-oxoethyl]carbamate.
What is the SMILES notation for methyl N-[2-(2,5-dichlorothiophen-3-yl)-2-oxoethyl]carbamate?
The canonical SMILES for methyl N-[2-(2,5-dichlorothiophen-3-yl)-2-oxoethyl]carbamate is COC(=O)NCC(=O)c1cc(Cl)sc1Cl.
What is the InChIKey of methyl N-[2-(2,5-dichlorothiophen-3-yl)-2-oxoethyl]carbamate?
The InChIKey is IEUJDXNFZLBZGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7Cl2NO3S/c1-14-8(13)11-3-5(12)4-2-6(9)15-7(4)10/h2H,3H2,1H3,(H,11,13).
What are the key properties of methyl N-[2-(2,5-dichlorothiophen-3-yl)-2-oxoethyl]carbamate?
methyl N-[2-(2,5-dichlorothiophen-3-yl)-2-oxoethyl]carbamate has a molecular weight of 268.12 g/mol, XLogP of 2.59, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[2-(2,5-dichlorothiophen-3-yl)-2-oxoethyl]carbamate is sourced from PubChem (CID 21283503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).