C13H18Cl2OS — CID 65450253
1-(2,5-dichlorothiophen-3-yl)nonan-1-one (PubChem CID 65450253) has the molecular formula C13H18Cl2OS and a molecular weight of 293.26 g/mol. Its IUPAC name is 1-(2,5-dichlorothiophen-3-yl)nonan-1-one.
| Compound Name | 1-(2,5-dichlorothiophen-3-yl)nonan-1-one |
|---|---|
| PubChem CID | 65450253 |
| Molecular Formula | C13H18Cl2OS |
| Molecular Weight | 293.26 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | 1-(2,5-dichlorothiophen-3-yl)nonan-1-one |
| SMILES | CCCCCCCCC(=O)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C13H18Cl2OS/c1-2-3-4-5-6-7-8-11(16)10-9-12(14)17-13(10)15/h9H,2-8H2,1H3 |
| InChIKey | UIANQMDUZWVVBN-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.26 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|