C10H8Cl2OS — CID 107967789
1-(2,5-dichlorothiophen-3-yl)hex-4-yn-1-one (PubChem CID 107967789) has the molecular formula C10H8Cl2OS and a molecular weight of 247.15 g/mol. Its IUPAC name is 1-(2,5-dichlorothiophen-3-yl)hex-4-yn-1-one.
| Compound Name | 1-(2,5-dichlorothiophen-3-yl)hex-4-yn-1-one |
|---|---|
| PubChem CID | 107967789 |
| Molecular Formula | C10H8Cl2OS |
| Molecular Weight | 247.15 g/mol |
| Exact Mass | 245.97 |
| IUPAC Name | 1-(2,5-dichlorothiophen-3-yl)hex-4-yn-1-one |
| SMILES | CC#CCCC(=O)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C10H8Cl2OS/c1-2-3-4-5-8(13)7-6-9(11)14-10(7)12/h6H,4-5H2,1H3 |
| InChIKey | RAWSOKIKAUQJPB-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.15 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|