C12H10Cl2O — CID 115801520
1-(2,5-dichlorophenyl)hex-4-yn-1-one (PubChem CID 115801520) has the molecular formula C12H10Cl2O and a molecular weight of 241.12 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)hex-4-yn-1-one.
| Compound Name | 1-(2,5-dichlorophenyl)hex-4-yn-1-one |
|---|---|
| PubChem CID | 115801520 |
| Molecular Formula | C12H10Cl2O |
| Molecular Weight | 241.12 g/mol |
| Exact Mass | 240.01 |
| IUPAC Name | 1-(2,5-dichlorophenyl)hex-4-yn-1-one |
| SMILES | CC#CCCC(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C12H10Cl2O/c1-2-3-4-5-12(15)10-8-9(13)6-7-11(10)14/h6-8H,4-5H2,1H3 |
| InChIKey | ZQFBTMIFCQKDST-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.12 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|