C14H18Cl2O2 — CID 21284637
1-(3,5-dichloro-2-hydroxyphenyl)octan-1-one (PubChem CID 21284637) has the molecular formula C14H18Cl2O2 and a molecular weight of 289.20 g/mol. Its IUPAC name is 1-(3,5-dichloro-2-hydroxyphenyl)octan-1-one.
| Compound Name | 1-(3,5-dichloro-2-hydroxyphenyl)octan-1-one |
|---|---|
| PubChem CID | 21284637 |
| Molecular Formula | C14H18Cl2O2 |
| Molecular Weight | 289.20 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 1-(3,5-dichloro-2-hydroxyphenyl)octan-1-one |
| SMILES | CCCCCCCC(=O)c1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C14H18Cl2O2/c1-2-3-4-5-6-7-13(17)11-8-10(15)9-12(16)14(11)18/h8-9,18H,2-7H2,1H3 |
| InChIKey | IWTYIJDYENEWIK-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.20 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|