C9H10Cl2O2S2 — CID 43801651
1-(2,5-dichlorothiophen-3-yl)-2-(2-methoxyethylsulfanyl)ethanone (PubChem CID 43801651) has the molecular formula C9H10Cl2O2S2 and a molecular weight of 285.22 g/mol. Its IUPAC name is 1-(2,5-dichlorothiophen-3-yl)-2-(2-methoxyethylsulfanyl)ethanone.
| Compound Name | 1-(2,5-dichlorothiophen-3-yl)-2-(2-methoxyethylsulfanyl)ethanone |
|---|---|
| PubChem CID | 43801651 |
| Molecular Formula | C9H10Cl2O2S2 |
| Molecular Weight | 285.22 g/mol |
| Exact Mass | 283.95 |
| IUPAC Name | 1-(2,5-dichlorothiophen-3-yl)-2-(2-methoxyethylsulfanyl)ethanone |
| SMILES | COCCSCC(=O)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C9H10Cl2O2S2/c1-13-2-3-14-5-7(12)6-4-8(10)15-9(6)11/h4H,2-3,5H2,1H3 |
| InChIKey | VRVPWLKDDPZDAK-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.22 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|