C11H12Cl2O2S2 — CID 64639379
2-cyclopentylsulfinyl-1-(2,5-dichlorothiophen-3-yl)ethanone (PubChem CID 64639379) has the molecular formula C11H12Cl2O2S2 and a molecular weight of 311.26 g/mol. Its IUPAC name is 2-cyclopentylsulfinyl-1-(2,5-dichlorothiophen-3-yl)ethanone.
| Compound Name | 2-cyclopentylsulfinyl-1-(2,5-dichlorothiophen-3-yl)ethanone |
|---|---|
| PubChem CID | 64639379 |
| Molecular Formula | C11H12Cl2O2S2 |
| Molecular Weight | 311.26 g/mol |
| Exact Mass | 309.97 |
| IUPAC Name | 2-cyclopentylsulfinyl-1-(2,5-dichlorothiophen-3-yl)ethanone |
| SMILES | O=C(CS(=O)C1CCCC1)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C11H12Cl2O2S2/c12-10-5-8(11(13)16-10)9(14)6-17(15)7-3-1-2-4-7/h5,7H,1-4,6H2 |
| InChIKey | XOASMUXXXBQSCL-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.26 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |