C13H18NO2S+ — CID 4739933
4-methoxy-3-(thiomorpholin-4-ium-4-ylmethyl)benzaldehyde (PubChem CID 4739933) has the molecular formula C13H18NO2S+ and a molecular weight of 252.36 g/mol. Its IUPAC name is 4-methoxy-3-(thiomorpholin-4-ium-4-ylmethyl)benzaldehyde.
| Compound Name | 4-methoxy-3-(thiomorpholin-4-ium-4-ylmethyl)benzaldehyde |
|---|---|
| PubChem CID | 4739933 |
| Molecular Formula | C13H18NO2S+ |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | 4-methoxy-3-(thiomorpholin-4-ium-4-ylmethyl)benzaldehyde |
| SMILES | COc1ccc(C=O)cc1C[NH+]1CCSCC1 |
| InChI | InChI=1S/C13H17NO2S/c1-16-13-3-2-11(10-15)8-12(13)9-14-4-6-17-7-5-14/h2-3,8,10H,4-7,9H2,1H3/p+1 |
| InChIKey | JYURGPQYEDOSEU-UHFFFAOYSA-O |
| XLogP | 0.64 |
| TPSA | 30.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|