C21H23N2O3S2+ — CID 2211760
(E)-2-(benzenesulfonyl)-3-[4-methoxy-3-(thiomorpholin-4-ium-4-ylmethyl)phenyl]prop-2-enenitrile (PubChem CID 2211760) has the molecular formula C21H23N2O3S2+ and a molecular weight of 415.56 g/mol. Its IUPAC name is (E)-2-(benzenesulfonyl)-3-[4-methoxy-3-(thiomorpholin-4-ium-4-ylmethyl)phenyl]prop-2-enenitrile.
| Compound Name | (E)-2-(benzenesulfonyl)-3-[4-methoxy-3-(thiomorpholin-4-ium-4-ylmethyl)phenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 2211760 |
| Molecular Formula | C21H23N2O3S2+ |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | (E)-2-(benzenesulfonyl)-3-[4-methoxy-3-(thiomorpholin-4-ium-4-ylmethyl)phenyl]prop-2-enenitrile |
| SMILES | COc1ccc(/C=C(\C#N)S(=O)(=O)c2ccccc2)cc1C[NH+]1CCSCC1 |
| InChI | InChI=1S/C21H22N2O3S2/c1-26-21-8-7-17(13-18(21)16-23-9-11-27-12-10-23)14-20(15-22)28(24,25)19-5-3-2-4-6-19/h2-8,13-14H,9-12,16H2,1H3/p+1/b20-14+ |
| InChIKey | UOFOTSZMKVTLOE-XSFVSMFZSA-O |
| XLogP | 2.17 |
| TPSA | 71.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|