C4H2Cl2OS — CID 71437780
2,5-dichlorothiophen-3-ol (PubChem CID 71437780) has the molecular formula C4H2Cl2OS and a molecular weight of 169.03 g/mol. Its IUPAC name is 2,5-dichlorothiophen-3-ol.
| Compound Name | 2,5-dichlorothiophen-3-ol |
|---|---|
| PubChem CID | 71437780 |
| Molecular Formula | C4H2Cl2OS |
| Molecular Weight | 169.03 g/mol |
| Exact Mass | 167.92 |
| IUPAC Name | 2,5-dichlorothiophen-3-ol |
| SMILES | Oc1cc(Cl)sc1Cl |
| InChI | InChI=1S/C4H2Cl2OS/c5-3-1-2(7)4(6)8-3/h1,7H |
| InChIKey | UGWWXUAICFVOLO-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.03 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'} |
|---|