C6H2Cl2F2OS — CID 103513606
1-(2,5-dichlorothiophen-3-yl)-2,2-difluoroethanone (PubChem CID 103513606) has the molecular formula C6H2Cl2F2OS and a molecular weight of 231.05 g/mol. Its IUPAC name is 1-(2,5-dichlorothiophen-3-yl)-2,2-difluoroethanone.
| Compound Name | 1-(2,5-dichlorothiophen-3-yl)-2,2-difluoroethanone |
|---|---|
| PubChem CID | 103513606 |
| Molecular Formula | C6H2Cl2F2OS |
| Molecular Weight | 231.05 g/mol |
| Exact Mass | 229.92 |
| IUPAC Name | 1-(2,5-dichlorothiophen-3-yl)-2,2-difluoroethanone |
| SMILES | O=C(c1cc(Cl)sc1Cl)C(F)F |
| InChI | InChI=1S/C6H2Cl2F2OS/c7-3-1-2(5(8)12-3)4(11)6(9)10/h1,6H |
| InChIKey | IAEYDNXLRUMVBR-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.05 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |