C8H2Cl2N2S — CID 131048965
2-[(2,5-dichlorothiophen-3-yl)methylidene]propanedinitrile (PubChem CID 131048965) has the molecular formula C8H2Cl2N2S and a molecular weight of 229.09 g/mol. Its IUPAC name is 2-[(2,5-dichlorothiophen-3-yl)methylidene]propanedinitrile.
| Compound Name | 2-[(2,5-dichlorothiophen-3-yl)methylidene]propanedinitrile |
|---|---|
| PubChem CID | 131048965 |
| Molecular Formula | C8H2Cl2N2S |
| Molecular Weight | 229.09 g/mol |
| Exact Mass | 227.93 |
| IUPAC Name | 2-[(2,5-dichlorothiophen-3-yl)methylidene]propanedinitrile |
| SMILES | N#CC(C#N)=Cc1cc(Cl)sc1Cl |
| InChI | InChI=1S/C8H2Cl2N2S/c9-7-2-6(8(10)13-7)1-5(3-11)4-12/h1-2H |
| InChIKey | XMWUYDQZLAAQEX-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.09 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|