C10H6N2O2 — CID 23057144
2-[(2,3-dihydroxyphenyl)methylidene]propanedinitrile (PubChem CID 23057144) has the molecular formula C10H6N2O2 and a molecular weight of 186.17 g/mol. Its IUPAC name is 2-[(2,3-dihydroxyphenyl)methylidene]propanedinitrile.
| Compound Name | 2-[(2,3-dihydroxyphenyl)methylidene]propanedinitrile |
|---|---|
| PubChem CID | 23057144 |
| Molecular Formula | C10H6N2O2 |
| Molecular Weight | 186.17 g/mol |
| Exact Mass | 186.04 |
| IUPAC Name | 2-[(2,3-dihydroxyphenyl)methylidene]propanedinitrile |
| SMILES | N#CC(C#N)=Cc1cccc(O)c1O |
| InChI | InChI=1S/C10H6N2O2/c11-5-7(6-12)4-8-2-1-3-9(13)10(8)14/h1-4,13-14H |
| InChIKey | DLFMRQWQHPWINB-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 88.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.17 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|