C10H7N3O2 — CID 23617874
2-(2,2-dicyanoethenyl)-N-hydroxybenzeneamine oxide (PubChem CID 23617874) has the molecular formula C10H7N3O2 and a molecular weight of 201.18 g/mol. Its IUPAC name is 2-(2,2-dicyanoethenyl)-N-hydroxybenzeneamine oxide.
| Compound Name | 2-(2,2-dicyanoethenyl)-N-hydroxybenzeneamine oxide |
|---|---|
| PubChem CID | 23617874 |
| Molecular Formula | C10H7N3O2 |
| Molecular Weight | 201.18 g/mol |
| Exact Mass | 201.05 |
| IUPAC Name | 2-(2,2-dicyanoethenyl)-N-hydroxybenzeneamine oxide |
| SMILES | N#CC(C#N)=Cc1ccccc1[NH+]([O-])O |
| InChI | InChI=1S/C10H7N3O2/c11-6-8(7-12)5-9-3-1-2-4-10(9)13(14)15/h1-5,13-14H |
| InChIKey | BNTSQCPVNKXYBU-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 95.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.18 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|