C17H7Cl3N2O2 — CID 22899732
(2,4,5-trichlorophenyl) 2-(2,2-dicyanoethenyl)benzoate (PubChem CID 22899732) has the molecular formula C17H7Cl3N2O2 and a molecular weight of 377.61 g/mol. Its IUPAC name is (2,4,5-trichlorophenyl) 2-(2,2-dicyanoethenyl)benzoate.
| Compound Name | (2,4,5-trichlorophenyl) 2-(2,2-dicyanoethenyl)benzoate |
|---|---|
| PubChem CID | 22899732 |
| Molecular Formula | C17H7Cl3N2O2 |
| Molecular Weight | 377.61 g/mol |
| Exact Mass | 375.96 |
| IUPAC Name | (2,4,5-trichlorophenyl) 2-(2,2-dicyanoethenyl)benzoate |
| SMILES | N#CC(C#N)=Cc1ccccc1C(=O)Oc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C17H7Cl3N2O2/c18-13-6-15(20)16(7-14(13)19)24-17(23)12-4-2-1-3-11(12)5-10(8-21)9-22/h1-7H |
| InChIKey | AOLGKCDWTLSNDS-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 73.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.61 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|