C18H12ClFN2O3 — CID 9353337
methyl 2-[(E)-3-(3-chloro-4-fluoroanilino)-2-cyano-3-oxoprop-1-enyl]benzoate (PubChem CID 9353337) has the molecular formula C18H12ClFN2O3 and a molecular weight of 358.76 g/mol. Its IUPAC name is methyl 2-[(E)-3-(3-chloro-4-fluoroanilino)-2-cyano-3-oxoprop-1-enyl]benzoate.
| Compound Name | methyl 2-[(E)-3-(3-chloro-4-fluoroanilino)-2-cyano-3-oxoprop-1-enyl]benzoate |
|---|---|
| PubChem CID | 9353337 |
| Molecular Formula | C18H12ClFN2O3 |
| Molecular Weight | 358.76 g/mol |
| Exact Mass | 358.05 |
| IUPAC Name | methyl 2-[(E)-3-(3-chloro-4-fluoroanilino)-2-cyano-3-oxoprop-1-enyl]benzoate |
| SMILES | COC(=O)c1ccccc1/C=C(\C#N)C(=O)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C18H12ClFN2O3/c1-25-18(24)14-5-3-2-4-11(14)8-12(10-21)17(23)22-13-6-7-16(20)15(19)9-13/h2-9H,1H3,(H,22,23)/b12-8+ |
| InChIKey | SOOZLJPYJCFLFO-XYOKQWHBSA-N |
| XLogP | 3.81 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.76 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|