C20H18N2O5 — CID 9353326
methyl 2-[(E)-2-cyano-3-(3,4-dimethoxyanilino)-3-oxoprop-1-enyl]benzoate (PubChem CID 9353326) has the molecular formula C20H18N2O5 and a molecular weight of 366.37 g/mol. Its IUPAC name is methyl 2-[(E)-2-cyano-3-(3,4-dimethoxyanilino)-3-oxoprop-1-enyl]benzoate.
| Compound Name | methyl 2-[(E)-2-cyano-3-(3,4-dimethoxyanilino)-3-oxoprop-1-enyl]benzoate |
|---|---|
| PubChem CID | 9353326 |
| Molecular Formula | C20H18N2O5 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | methyl 2-[(E)-2-cyano-3-(3,4-dimethoxyanilino)-3-oxoprop-1-enyl]benzoate |
| SMILES | COC(=O)c1ccccc1/C=C(\C#N)C(=O)Nc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C20H18N2O5/c1-25-17-9-8-15(11-18(17)26-2)22-19(23)14(12-21)10-13-6-4-5-7-16(13)20(24)27-3/h4-11H,1-3H3,(H,22,23)/b14-10+ |
| InChIKey | HKTKEXSZWORSPY-GXDHUFHOSA-N |
| XLogP | 3.04 |
| TPSA | 97.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|