C18H13ClFN3O3 — CID 108851627
methyl 2-[[(Z)-3-(3-chloro-4-fluoroanilino)-2-cyanoprop-2-enoyl]amino]benzoate (PubChem CID 108851627) has the molecular formula C18H13ClFN3O3 and a molecular weight of 373.77 g/mol. Its IUPAC name is methyl 2-[[(Z)-3-(3-chloro-4-fluoroanilino)-2-cyanoprop-2-enoyl]amino]benzoate.
| Compound Name | methyl 2-[[(Z)-3-(3-chloro-4-fluoroanilino)-2-cyanoprop-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 108851627 |
| Molecular Formula | C18H13ClFN3O3 |
| Molecular Weight | 373.77 g/mol |
| Exact Mass | 373.06 |
| IUPAC Name | methyl 2-[[(Z)-3-(3-chloro-4-fluoroanilino)-2-cyanoprop-2-enoyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)/C(C#N)=C\Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C18H13ClFN3O3/c1-26-18(25)13-4-2-3-5-16(13)23-17(24)11(9-21)10-22-12-6-7-15(20)14(19)8-12/h2-8,10,22H,1H3,(H,23,24)/b11-10- |
| InChIKey | VENUAYNLMVMILW-KHPPLWFESA-N |
| XLogP | 3.72 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.77 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|