About (Z)-but-2-enedinitrile;2,3-dihydroxybenzaldehyde
(Z)-but-2-enedinitrile;2,3-dihydroxybenzaldehyde (PubChem CID 175422336) has the molecular formula C11H8N2O3
and a molecular weight of 216.20 g/mol. Its IUPAC name is (Z)-but-2-enedinitrile;2,3-dihydroxybenzaldehyde.
Molecular Properties
| Compound Name | (Z)-but-2-enedinitrile;2,3-dihydroxybenzaldehyde |
| PubChem CID | 175422336 |
| Molecular Formula | C11H8N2O3 |
| Molecular Weight | 216.20 g/mol |
| Exact Mass | 216.05 |
| IUPAC Name | (Z)-but-2-enedinitrile;2,3-dihydroxybenzaldehyde |
| SMILES | N#C/C=C\C#N.O=Cc1cccc(O)c1O |
| InChI | InChI=1S/C7H6O3.C4H2N2/c8-4-5-2-1-3-6(9)7(5)10;5-3-1-2-4-6/h1-4,9-10H;1-2H/b;2-1- |
| InChIKey | JYGKSFXEBBYXQS-BTJKTKAUSA-N |
| XLogP | 1.50 |
| TPSA | 105.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.20 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze (Z)-but-2-enedinitrile;2,3-dihydroxybenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-but-2-enedinitrile;2,3-dihydroxybenzaldehyde?
The IUPAC name of (Z)-but-2-enedinitrile;2,3-dihydroxybenzaldehyde (CID 175422336) is (Z)-but-2-enedinitrile;2,3-dihydroxybenzaldehyde.
What is the SMILES notation for (Z)-but-2-enedinitrile;2,3-dihydroxybenzaldehyde?
The canonical SMILES for (Z)-but-2-enedinitrile;2,3-dihydroxybenzaldehyde is N#C/C=C\C#N.O=Cc1cccc(O)c1O.
What is the InChIKey of (Z)-but-2-enedinitrile;2,3-dihydroxybenzaldehyde?
The InChIKey is JYGKSFXEBBYXQS-BTJKTKAUSA-N. The full InChI is InChI=1S/C7H6O3.C4H2N2/c8-4-5-2-1-3-6(9)7(5)10;5-3-1-2-4-6/h1-4,9-10H;1-2H/b;2-1-.
What are the key properties of (Z)-but-2-enedinitrile;2,3-dihydroxybenzaldehyde?
(Z)-but-2-enedinitrile;2,3-dihydroxybenzaldehyde has a molecular weight of 216.20 g/mol, XLogP of 1.50, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-but-2-enedinitrile;2,3-dihydroxybenzaldehyde is sourced from PubChem (CID 175422336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).