C9H7Cl3N2S — CID 130705880
4-(chloromethyl)-1-[(2,5-dichlorothiophen-3-yl)methyl]imidazole (PubChem CID 130705880) has the molecular formula C9H7Cl3N2S and a molecular weight of 281.60 g/mol. Its IUPAC name is 4-(chloromethyl)-1-[(2,5-dichlorothiophen-3-yl)methyl]imidazole.
| Compound Name | 4-(chloromethyl)-1-[(2,5-dichlorothiophen-3-yl)methyl]imidazole |
|---|---|
| PubChem CID | 130705880 |
| Molecular Formula | C9H7Cl3N2S |
| Molecular Weight | 281.60 g/mol |
| Exact Mass | 279.94 |
| IUPAC Name | 4-(chloromethyl)-1-[(2,5-dichlorothiophen-3-yl)methyl]imidazole |
| SMILES | ClCc1cn(Cc2cc(Cl)sc2Cl)cn1 |
| InChI | InChI=1S/C9H7Cl3N2S/c10-2-7-4-14(5-13-7)3-6-1-8(11)15-9(6)12/h1,4-5H,2-3H2 |
| InChIKey | YJEHJDYUXLNYPG-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.60 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|