C9H10ClN3S — CID 106718039
[1-[(5-chlorothiophen-2-yl)methyl]imidazol-4-yl]methanamine (PubChem CID 106718039) has the molecular formula C9H10ClN3S and a molecular weight of 227.72 g/mol. Its IUPAC name is [1-[(5-chlorothiophen-2-yl)methyl]imidazol-4-yl]methanamine.
| Compound Name | [1-[(5-chlorothiophen-2-yl)methyl]imidazol-4-yl]methanamine |
|---|---|
| PubChem CID | 106718039 |
| Molecular Formula | C9H10ClN3S |
| Molecular Weight | 227.72 g/mol |
| Exact Mass | 227.03 |
| IUPAC Name | [1-[(5-chlorothiophen-2-yl)methyl]imidazol-4-yl]methanamine |
| SMILES | NCc1cn(Cc2ccc(Cl)s2)cn1 |
| InChI | InChI=1S/C9H10ClN3S/c10-9-2-1-8(14-9)5-13-4-7(3-11)12-6-13/h1-2,4,6H,3,5,11H2 |
| InChIKey | PDHRJTMFDDZVTM-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.72 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |