About [1-(pyridin-4-ylmethyl)imidazol-4-yl]methanamine;hydrochloride
[1-(pyridin-4-ylmethyl)imidazol-4-yl]methanamine;hydrochloride (PubChem CID 131637694) has the molecular formula C10H13ClN4
and a molecular weight of 224.70 g/mol. Its IUPAC name is [1-(pyridin-4-ylmethyl)imidazol-4-yl]methanamine;hydrochloride.
Molecular Properties
| Compound Name | [1-(pyridin-4-ylmethyl)imidazol-4-yl]methanamine;hydrochloride |
| PubChem CID | 131637694 |
| Molecular Formula | C10H13ClN4 |
| Molecular Weight | 224.70 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | [1-(pyridin-4-ylmethyl)imidazol-4-yl]methanamine;hydrochloride |
| SMILES | Cl.NCc1cn(Cc2ccncc2)cn1 |
| InChI | InChI=1S/C10H12N4.ClH/c11-5-10-7-14(8-13-10)6-9-1-3-12-4-2-9;/h1-4,7-8H,5-6,11H2;1H |
| InChIKey | HLTNEVJTBZQDCE-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.70 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1-(pyridin-4-ylmethyl)imidazol-4-yl]methanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(pyridin-4-ylmethyl)imidazol-4-yl]methanamine;hydrochloride?
The IUPAC name of [1-(pyridin-4-ylmethyl)imidazol-4-yl]methanamine;hydrochloride (CID 131637694) is [1-(pyridin-4-ylmethyl)imidazol-4-yl]methanamine;hydrochloride.
What is the SMILES notation for [1-(pyridin-4-ylmethyl)imidazol-4-yl]methanamine;hydrochloride?
The canonical SMILES for [1-(pyridin-4-ylmethyl)imidazol-4-yl]methanamine;hydrochloride is Cl.NCc1cn(Cc2ccncc2)cn1.
What is the InChIKey of [1-(pyridin-4-ylmethyl)imidazol-4-yl]methanamine;hydrochloride?
The InChIKey is HLTNEVJTBZQDCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N4.ClH/c11-5-10-7-14(8-13-10)6-9-1-3-12-4-2-9;/h1-4,7-8H,5-6,11H2;1H.
What are the key properties of [1-(pyridin-4-ylmethyl)imidazol-4-yl]methanamine;hydrochloride?
[1-(pyridin-4-ylmethyl)imidazol-4-yl]methanamine;hydrochloride has a molecular weight of 224.70 g/mol, XLogP of 1.21, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(pyridin-4-ylmethyl)imidazol-4-yl]methanamine;hydrochloride is sourced from PubChem (CID 131637694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).