C8H6Cl2N2S — CID 130048890
(2,7-dichlorothieno[2,3-c]pyridin-4-yl)methanamine (PubChem CID 130048890) has the molecular formula C8H6Cl2N2S and a molecular weight of 233.12 g/mol. Its IUPAC name is (2,7-dichlorothieno[2,3-c]pyridin-4-yl)methanamine.
| Compound Name | (2,7-dichlorothieno[2,3-c]pyridin-4-yl)methanamine |
|---|---|
| PubChem CID | 130048890 |
| Molecular Formula | C8H6Cl2N2S |
| Molecular Weight | 233.12 g/mol |
| Exact Mass | 231.96 |
| IUPAC Name | (2,7-dichlorothieno[2,3-c]pyridin-4-yl)methanamine |
| SMILES | NCc1cnc(Cl)c2sc(Cl)cc12 |
| InChI | InChI=1S/C8H6Cl2N2S/c9-6-1-5-4(2-11)3-12-8(10)7(5)13-6/h1,3H,2,11H2 |
| InChIKey | QVTVXWYKYDNDIS-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.12 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|