C10H13ClN2S — CID 115036950
[2-chloro-5-(thiolan-3-yl)-3-pyridinyl]methanamine (PubChem CID 115036950) has the molecular formula C10H13ClN2S and a molecular weight of 228.75 g/mol. Its IUPAC name is [2-chloro-5-(thiolan-3-yl)-3-pyridinyl]methanamine.
| Compound Name | [2-chloro-5-(thiolan-3-yl)-3-pyridinyl]methanamine |
|---|---|
| PubChem CID | 115036950 |
| Molecular Formula | C10H13ClN2S |
| Molecular Weight | 228.75 g/mol |
| Exact Mass | 228.05 |
| IUPAC Name | [2-chloro-5-(thiolan-3-yl)-3-pyridinyl]methanamine |
| SMILES | NCc1cc(C2CCSC2)cnc1Cl |
| InChI | InChI=1S/C10H13ClN2S/c11-10-8(4-12)3-9(5-13-10)7-1-2-14-6-7/h3,5,7H,1-2,4,6,12H2 |
| InChIKey | PPMJBVLYPMIYCX-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.75 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|