C6H8Cl4N2 — CID 155978043
(2,5-dichloro-4-pyridinyl)methanamine;dihydrochloride (PubChem CID 155978043) has the molecular formula C6H8Cl4N2 and a molecular weight of 249.96 g/mol. Its IUPAC name is (2,5-dichloro-4-pyridinyl)methanamine;dihydrochloride.
| Compound Name | (2,5-dichloro-4-pyridinyl)methanamine;dihydrochloride |
|---|---|
| PubChem CID | 155978043 |
| Molecular Formula | C6H8Cl4N2 |
| Molecular Weight | 249.96 g/mol |
| Exact Mass | 247.94 |
| IUPAC Name | (2,5-dichloro-4-pyridinyl)methanamine;dihydrochloride |
| SMILES | Cl.Cl.NCc1cc(Cl)ncc1Cl |
| InChI | InChI=1S/C6H6Cl2N2.2ClH/c7-5-3-10-6(8)1-4(5)2-9;;/h1,3H,2,9H2;2*1H |
| InChIKey | VMKDSNQACJLMLY-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.96 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|