C5H5Cl3N2 — CID 134128726
2,5-dichloropyridin-4-amine;hydrochloride (PubChem CID 134128726) has the molecular formula C5H5Cl3N2 and a molecular weight of 199.47 g/mol. Its IUPAC name is 2,5-dichloropyridin-4-amine;hydrochloride.
| Compound Name | 2,5-dichloropyridin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 134128726 |
| Molecular Formula | C5H5Cl3N2 |
| Molecular Weight | 199.47 g/mol |
| Exact Mass | 197.95 |
| IUPAC Name | 2,5-dichloropyridin-4-amine;hydrochloride |
| SMILES | Cl.Nc1cc(Cl)ncc1Cl |
| InChI | InChI=1S/C5H4Cl2N2.ClH/c6-3-2-9-5(7)1-4(3)8;/h1-2H,(H2,8,9);1H |
| InChIKey | WNGUDDCMGHLESE-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.47 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|