C10H14ClN3 — CID 114925351
4-(aminomethyl)-5-chloro-N-cyclopropyl-N-methylpyridin-2-amine (PubChem CID 114925351) has the molecular formula C10H14ClN3 and a molecular weight of 211.70 g/mol. Its IUPAC name is 4-(aminomethyl)-5-chloro-N-cyclopropyl-N-methylpyridin-2-amine.
| Compound Name | 4-(aminomethyl)-5-chloro-N-cyclopropyl-N-methylpyridin-2-amine |
|---|---|
| PubChem CID | 114925351 |
| Molecular Formula | C10H14ClN3 |
| Molecular Weight | 211.70 g/mol |
| Exact Mass | 211.09 |
| IUPAC Name | 4-(aminomethyl)-5-chloro-N-cyclopropyl-N-methylpyridin-2-amine |
| SMILES | CN(c1cc(CN)c(Cl)cn1)C1CC1 |
| InChI | InChI=1S/C10H14ClN3/c1-14(8-2-3-8)10-4-7(5-12)9(11)6-13-10/h4,6,8H,2-3,5,12H2,1H3 |
| InChIKey | NGIJYDJJRKJOET-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.70 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |