C10H16ClN3O2S — CID 114926756
4-(aminomethyl)-5-chloro-N-methyl-N-(2-methylsulfonylethyl)pyridin-2-amine (PubChem CID 114926756) has the molecular formula C10H16ClN3O2S and a molecular weight of 277.78 g/mol. Its IUPAC name is 4-(aminomethyl)-5-chloro-N-methyl-N-(2-methylsulfonylethyl)pyridin-2-amine.
| Compound Name | 4-(aminomethyl)-5-chloro-N-methyl-N-(2-methylsulfonylethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 114926756 |
| Molecular Formula | C10H16ClN3O2S |
| Molecular Weight | 277.78 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 4-(aminomethyl)-5-chloro-N-methyl-N-(2-methylsulfonylethyl)pyridin-2-amine |
| SMILES | CN(CCS(C)(=O)=O)c1cc(CN)c(Cl)cn1 |
| InChI | InChI=1S/C10H16ClN3O2S/c1-14(3-4-17(2,15)16)10-5-8(6-12)9(11)7-13-10/h5,7H,3-4,6,12H2,1-2H3 |
| InChIKey | HVMLVRXQIZAFEB-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.78 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |