C10H14Cl2N2 — CID 114920828
5-chloro-4-(chloromethyl)-N-methyl-N-propylpyridin-2-amine (PubChem CID 114920828) has the molecular formula C10H14Cl2N2 and a molecular weight of 233.14 g/mol. Its IUPAC name is 5-chloro-4-(chloromethyl)-N-methyl-N-propylpyridin-2-amine.
| Compound Name | 5-chloro-4-(chloromethyl)-N-methyl-N-propylpyridin-2-amine |
|---|---|
| PubChem CID | 114920828 |
| Molecular Formula | C10H14Cl2N2 |
| Molecular Weight | 233.14 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | 5-chloro-4-(chloromethyl)-N-methyl-N-propylpyridin-2-amine |
| SMILES | CCCN(C)c1cc(CCl)c(Cl)cn1 |
| InChI | InChI=1S/C10H14Cl2N2/c1-3-4-14(2)10-5-8(6-11)9(12)7-13-10/h5,7H,3-4,6H2,1-2H3 |
| InChIKey | PYENJVLDNJALGQ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.14 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|