C11H16Cl2N2O — CID 114921039
5-chloro-4-(chloromethyl)-N-(3-methoxypropyl)-N-methylpyridin-2-amine (PubChem CID 114921039) has the molecular formula C11H16Cl2N2O and a molecular weight of 263.17 g/mol. Its IUPAC name is 5-chloro-4-(chloromethyl)-N-(3-methoxypropyl)-N-methylpyridin-2-amine.
| Compound Name | 5-chloro-4-(chloromethyl)-N-(3-methoxypropyl)-N-methylpyridin-2-amine |
|---|---|
| PubChem CID | 114921039 |
| Molecular Formula | C11H16Cl2N2O |
| Molecular Weight | 263.17 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | 5-chloro-4-(chloromethyl)-N-(3-methoxypropyl)-N-methylpyridin-2-amine |
| SMILES | COCCCN(C)c1cc(CCl)c(Cl)cn1 |
| InChI | InChI=1S/C11H16Cl2N2O/c1-15(4-3-5-16-2)11-6-9(7-12)10(13)8-14-11/h6,8H,3-5,7H2,1-2H3 |
| InChIKey | JLPDMSKHPGFARG-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.17 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|