C11H16Cl2N2O — CID 116518970
N-[(4,6-dichloro-3-pyridinyl)methyl]-3-methoxy-N-methylpropan-1-amine (PubChem CID 116518970) has the molecular formula C11H16Cl2N2O and a molecular weight of 263.17 g/mol. Its IUPAC name is N-[(4,6-dichloro-3-pyridinyl)methyl]-3-methoxy-N-methylpropan-1-amine.
| Compound Name | N-[(4,6-dichloro-3-pyridinyl)methyl]-3-methoxy-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 116518970 |
| Molecular Formula | C11H16Cl2N2O |
| Molecular Weight | 263.17 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | N-[(4,6-dichloro-3-pyridinyl)methyl]-3-methoxy-N-methylpropan-1-amine |
| SMILES | COCCCN(C)Cc1cnc(Cl)cc1Cl |
| InChI | InChI=1S/C11H16Cl2N2O/c1-15(4-3-5-16-2)8-9-7-14-11(13)6-10(9)12/h6-7H,3-5,8H2,1-2H3 |
| InChIKey | QLXJFGHBTSMWCZ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.17 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|