C13H18Cl2N2O3 — CID 116519887
methyl 3-[(4,6-dichloro-3-pyridinyl)methyl-(2-methoxyethyl)amino]propanoate (PubChem CID 116519887) has the molecular formula C13H18Cl2N2O3 and a molecular weight of 321.20 g/mol. Its IUPAC name is methyl 3-[(4,6-dichloro-3-pyridinyl)methyl-(2-methoxyethyl)amino]propanoate.
| Compound Name | methyl 3-[(4,6-dichloro-3-pyridinyl)methyl-(2-methoxyethyl)amino]propanoate |
|---|---|
| PubChem CID | 116519887 |
| Molecular Formula | C13H18Cl2N2O3 |
| Molecular Weight | 321.20 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | methyl 3-[(4,6-dichloro-3-pyridinyl)methyl-(2-methoxyethyl)amino]propanoate |
| SMILES | COCCN(CCC(=O)OC)Cc1cnc(Cl)cc1Cl |
| InChI | InChI=1S/C13H18Cl2N2O3/c1-19-6-5-17(4-3-13(18)20-2)9-10-8-16-12(15)7-11(10)14/h7-8H,3-6,9H2,1-2H3 |
| InChIKey | OFSWUPRGYZKOIN-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.20 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|