C13H23N3O3 — CID 115536390
methyl 3-[(3-ethylimidazol-4-yl)methyl-(2-methoxyethyl)amino]propanoate (PubChem CID 115536390) has the molecular formula C13H23N3O3 and a molecular weight of 269.34 g/mol. Its IUPAC name is methyl 3-[(3-ethylimidazol-4-yl)methyl-(2-methoxyethyl)amino]propanoate.
| Compound Name | methyl 3-[(3-ethylimidazol-4-yl)methyl-(2-methoxyethyl)amino]propanoate |
|---|---|
| PubChem CID | 115536390 |
| Molecular Formula | C13H23N3O3 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.17 |
| IUPAC Name | methyl 3-[(3-ethylimidazol-4-yl)methyl-(2-methoxyethyl)amino]propanoate |
| SMILES | CCn1cncc1CN(CCOC)CCC(=O)OC |
| InChI | InChI=1S/C13H23N3O3/c1-4-16-11-14-9-12(16)10-15(7-8-18-2)6-5-13(17)19-3/h9,11H,4-8,10H2,1-3H3 |
| InChIKey | QDPBXSYIXALYLK-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |