About 1-(3-ethylimidazol-4-yl)-N,N-dimethylmethanamine
1-(3-ethylimidazol-4-yl)-N,N-dimethylmethanamine (PubChem CID 117192905) has the molecular formula C8H15N3
and a molecular weight of 153.23 g/mol. Its IUPAC name is 1-(3-ethylimidazol-4-yl)-N,N-dimethylmethanamine.
Analyze 1-(3-ethylimidazol-4-yl)-N,N-dimethylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-ethylimidazol-4-yl)-N,N-dimethylmethanamine?
The IUPAC name of 1-(3-ethylimidazol-4-yl)-N,N-dimethylmethanamine (CID 117192905) is 1-(3-ethylimidazol-4-yl)-N,N-dimethylmethanamine.
What is the SMILES notation for 1-(3-ethylimidazol-4-yl)-N,N-dimethylmethanamine?
The canonical SMILES for 1-(3-ethylimidazol-4-yl)-N,N-dimethylmethanamine is CCn1cncc1CN(C)C.
What is the InChIKey of 1-(3-ethylimidazol-4-yl)-N,N-dimethylmethanamine?
The InChIKey is GUDUTFFEORJXDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3/c1-4-11-7-9-5-8(11)6-10(2)3/h5,7H,4,6H2,1-3H3.
What are the key properties of 1-(3-ethylimidazol-4-yl)-N,N-dimethylmethanamine?
1-(3-ethylimidazol-4-yl)-N,N-dimethylmethanamine has a molecular weight of 153.23 g/mol, XLogP of 0.96, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-ethylimidazol-4-yl)-N,N-dimethylmethanamine is sourced from PubChem (CID 117192905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).