C16H23N3 — CID 124731647
(1R)-N-[(3-ethylimidazol-4-yl)methyl]-N-methyl-1-phenylpropan-1-amine (PubChem CID 124731647) has the molecular formula C16H23N3 and a molecular weight of 257.38 g/mol. Its IUPAC name is (1R)-N-[(3-ethylimidazol-4-yl)methyl]-N-methyl-1-phenylpropan-1-amine.
| Compound Name | (1R)-N-[(3-ethylimidazol-4-yl)methyl]-N-methyl-1-phenylpropan-1-amine |
|---|---|
| PubChem CID | 124731647 |
| Molecular Formula | C16H23N3 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.19 |
| IUPAC Name | (1R)-N-[(3-ethylimidazol-4-yl)methyl]-N-methyl-1-phenylpropan-1-amine |
| SMILES | CC[C@H](c1ccccc1)N(C)Cc1cncn1CC |
| InChI | InChI=1S/C16H23N3/c1-4-16(14-9-7-6-8-10-14)18(3)12-15-11-17-13-19(15)5-2/h6-11,13,16H,4-5,12H2,1-3H3/t16-/m1/s1 |
| InChIKey | UBQUZASUZDHRKG-MRXNPFEDSA-N |
| XLogP | 3.49 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |