C14H13BrCl2N2 — CID 116518849
1-(2-bromophenyl)-N-[(4,6-dichloro-3-pyridinyl)methyl]-N-methylmethanamine (PubChem CID 116518849) has the molecular formula C14H13BrCl2N2 and a molecular weight of 360.08 g/mol. Its IUPAC name is 1-(2-bromophenyl)-N-[(4,6-dichloro-3-pyridinyl)methyl]-N-methylmethanamine.
| Compound Name | 1-(2-bromophenyl)-N-[(4,6-dichloro-3-pyridinyl)methyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 116518849 |
| Molecular Formula | C14H13BrCl2N2 |
| Molecular Weight | 360.08 g/mol |
| Exact Mass | 357.96 |
| IUPAC Name | 1-(2-bromophenyl)-N-[(4,6-dichloro-3-pyridinyl)methyl]-N-methylmethanamine |
| SMILES | CN(Cc1cnc(Cl)cc1Cl)Cc1ccccc1Br |
| InChI | InChI=1S/C14H13BrCl2N2/c1-19(8-10-4-2-3-5-12(10)15)9-11-7-18-14(17)6-13(11)16/h2-7H,8-9H2,1H3 |
| InChIKey | DAQGIXDEGXCBNN-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.08 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|