C12H18Cl2N2 — CID 114920911
5-chloro-4-(chloromethyl)-N-methyl-N-(3-methylbutyl)pyridin-2-amine (PubChem CID 114920911) has the molecular formula C12H18Cl2N2 and a molecular weight of 261.20 g/mol. Its IUPAC name is 5-chloro-4-(chloromethyl)-N-methyl-N-(3-methylbutyl)pyridin-2-amine.
| Compound Name | 5-chloro-4-(chloromethyl)-N-methyl-N-(3-methylbutyl)pyridin-2-amine |
|---|---|
| PubChem CID | 114920911 |
| Molecular Formula | C12H18Cl2N2 |
| Molecular Weight | 261.20 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 5-chloro-4-(chloromethyl)-N-methyl-N-(3-methylbutyl)pyridin-2-amine |
| SMILES | CC(C)CCN(C)c1cc(CCl)c(Cl)cn1 |
| InChI | InChI=1S/C12H18Cl2N2/c1-9(2)4-5-16(3)12-6-10(7-13)11(14)8-15-12/h6,8-9H,4-5,7H2,1-3H3 |
| InChIKey | SJIYKDSFMOZMIP-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.20 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|