C7H6BrCl2NOS — CID 130671918
2-bromo-N-[(2,5-dichlorothiophen-3-yl)methyl]acetamide (PubChem CID 130671918) has the molecular formula C7H6BrCl2NOS and a molecular weight of 303.01 g/mol. Its IUPAC name is 2-bromo-N-[(2,5-dichlorothiophen-3-yl)methyl]acetamide.
| Compound Name | 2-bromo-N-[(2,5-dichlorothiophen-3-yl)methyl]acetamide |
|---|---|
| PubChem CID | 130671918 |
| Molecular Formula | C7H6BrCl2NOS |
| Molecular Weight | 303.01 g/mol |
| Exact Mass | 300.87 |
| IUPAC Name | 2-bromo-N-[(2,5-dichlorothiophen-3-yl)methyl]acetamide |
| SMILES | O=C(CBr)NCc1cc(Cl)sc1Cl |
| InChI | InChI=1S/C7H6BrCl2NOS/c8-2-6(12)11-3-4-1-5(9)13-7(4)10/h1H,2-3H2,(H,11,12) |
| InChIKey | PHDWBTGGPUYYJK-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.01 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|