C18H29I — CID 170062078
5-iodo-1,2,3-tris(2-methylpropyl)benzene (PubChem CID 170062078) has the molecular formula C18H29I and a molecular weight of 372.33 g/mol. Its IUPAC name is 5-iodo-1,2,3-tris(2-methylpropyl)benzene.
| Compound Name | 5-iodo-1,2,3-tris(2-methylpropyl)benzene |
|---|---|
| PubChem CID | 170062078 |
| Molecular Formula | C18H29I |
| Molecular Weight | 372.33 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | 5-iodo-1,2,3-tris(2-methylpropyl)benzene |
| SMILES | CC(C)Cc1cc(I)cc(CC(C)C)c1CC(C)C |
| InChI | InChI=1S/C18H29I/c1-12(2)7-15-10-17(19)11-16(8-13(3)4)18(15)9-14(5)6/h10-14H,7-9H2,1-6H3 |
| InChIKey | IJHCOTLRZNWMJV-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.33 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|