C13H20 — CID 22968949
1,2,4-trimethyl-5-(2-methylpropyl)benzene (PubChem CID 22968949) has the molecular formula C13H20 and a molecular weight of 176.30 g/mol. Its IUPAC name is 1,2,4-trimethyl-5-(2-methylpropyl)benzene.
| Compound Name | 1,2,4-trimethyl-5-(2-methylpropyl)benzene |
|---|---|
| PubChem CID | 22968949 |
| Molecular Formula | C13H20 |
| Molecular Weight | 176.30 g/mol |
| Exact Mass | 176.16 |
| IUPAC Name | 1,2,4-trimethyl-5-(2-methylpropyl)benzene |
| SMILES | Cc1cc(C)c(CC(C)C)cc1C |
| InChI | InChI=1S/C13H20/c1-9(2)6-13-8-11(4)10(3)7-12(13)5/h7-9H,6H2,1-5H3 |
| InChIKey | HTTRCGIYFZYUFH-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.30 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |