methyl 3-methyl-2-[(2,4,5-trimethylphenyl)methyl]butanoate

C16H24O2 — CID 116931426

IUPACmethyl 3-methyl-2-[(2,4,5-trimethylphenyl)methyl]butanoate
SMILESCOC(=O)C(Cc1cc(C)c(C)cc1C)C(C)C
InChIInChI=1S/C16H24O2/c1-10(2)15(16(17)18-6)9-14-8-12(4)11(3)7-13(14)5/h7-8,10,15H,9H2,1-6H3
InChIKeySLSWIANRPZVBHN-UHFFFAOYSA-N
MW248.37 g/mol
LogP3.60
Rot. Bonds4

About methyl 3-methyl-2-[(2,4,5-trimethylphenyl)methyl]butanoate

methyl 3-methyl-2-[(2,4,5-trimethylphenyl)methyl]butanoate (PubChem CID 116931426) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is methyl 3-methyl-2-[(2,4,5-trimethylphenyl)methyl]butanoate.

Molecular Properties

Compound Namemethyl 3-methyl-2-[(2,4,5-trimethylphenyl)methyl]butanoate
PubChem CID116931426
Molecular FormulaC16H24O2
Molecular Weight248.37 g/mol
Exact Mass248.18
IUPAC Namemethyl 3-methyl-2-[(2,4,5-trimethylphenyl)methyl]butanoate
SMILESCOC(=O)C(Cc1cc(C)c(C)cc1C)C(C)C
InChIInChI=1S/C16H24O2/c1-10(2)15(16(17)18-6)9-14-8-12(4)11(3)7-13(14)5/h7-8,10,15H,9H2,1-6H3
InChIKeySLSWIANRPZVBHN-UHFFFAOYSA-N
XLogP3.60
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500248.37
LogP ≤ 53.60
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze methyl 3-methyl-2-[(2,4,5-trimethylphenyl)methyl]butanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-methyl-2-[(2,4,5-trimethylphenyl)methyl]butanoate?
The IUPAC name of methyl 3-methyl-2-[(2,4,5-trimethylphenyl)methyl]butanoate (CID 116931426) is methyl 3-methyl-2-[(2,4,5-trimethylphenyl)methyl]butanoate.
What is the SMILES notation for methyl 3-methyl-2-[(2,4,5-trimethylphenyl)methyl]butanoate?
The canonical SMILES for methyl 3-methyl-2-[(2,4,5-trimethylphenyl)methyl]butanoate is COC(=O)C(Cc1cc(C)c(C)cc1C)C(C)C.
What is the InChIKey of methyl 3-methyl-2-[(2,4,5-trimethylphenyl)methyl]butanoate?
The InChIKey is SLSWIANRPZVBHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24O2/c1-10(2)15(16(17)18-6)9-14-8-12(4)11(3)7-13(14)5/h7-8,10,15H,9H2,1-6H3.
What are the key properties of methyl 3-methyl-2-[(2,4,5-trimethylphenyl)methyl]butanoate?
methyl 3-methyl-2-[(2,4,5-trimethylphenyl)methyl]butanoate has a molecular weight of 248.37 g/mol, XLogP of 3.60, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-methyl-2-[(2,4,5-trimethylphenyl)methyl]butanoate is sourced from PubChem (CID 116931426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).