C12H17Cl — CID 163503442
1-(2-chloropropyl)-2,4,5-trimethylbenzene (PubChem CID 163503442) has the molecular formula C12H17Cl and a molecular weight of 196.72 g/mol. Its IUPAC name is 1-(2-chloropropyl)-2,4,5-trimethylbenzene.
| Compound Name | 1-(2-chloropropyl)-2,4,5-trimethylbenzene |
|---|---|
| PubChem CID | 163503442 |
| Molecular Formula | C12H17Cl |
| Molecular Weight | 196.72 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | 1-(2-chloropropyl)-2,4,5-trimethylbenzene |
| SMILES | Cc1cc(C)c(CC(C)Cl)cc1C |
| InChI | InChI=1S/C12H17Cl/c1-8-5-10(3)12(6-9(8)2)7-11(4)13/h5-6,11H,7H2,1-4H3 |
| InChIKey | CWRANOTYBJDXJR-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.72 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|