C12H22 — CID 162125793
methane;1,2,4,5-tetramethylbenzene (PubChem CID 162125793) has the molecular formula C12H22 and a molecular weight of 166.31 g/mol. Its IUPAC name is methane;1,2,4,5-tetramethylbenzene.
| Compound Name | methane;1,2,4,5-tetramethylbenzene |
|---|---|
| PubChem CID | 162125793 |
| Molecular Formula | C12H22 |
| Molecular Weight | 166.31 g/mol |
| Exact Mass | 166.17 |
| IUPAC Name | methane;1,2,4,5-tetramethylbenzene |
| SMILES | C.C.Cc1cc(C)c(C)cc1C |
| InChI | InChI=1S/C10H14.2CH4/c1-7-5-9(3)10(4)6-8(7)2;;/h5-6H,1-4H3;2*1H4 |
| InChIKey | ZHZVNICDVXDFKO-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.31 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |