C15H30 — CID 144520627
ethane;methane;1,2,4,5-tetramethylbenzene (PubChem CID 144520627) has the molecular formula C15H30 and a molecular weight of 210.40 g/mol. Its IUPAC name is ethane;methane;1,2,4,5-tetramethylbenzene.
| Compound Name | ethane;methane;1,2,4,5-tetramethylbenzene |
|---|---|
| PubChem CID | 144520627 |
| Molecular Formula | C15H30 |
| Molecular Weight | 210.40 g/mol |
| Exact Mass | 210.23 |
| IUPAC Name | ethane;methane;1,2,4,5-tetramethylbenzene |
| SMILES | C.CC.CC.Cc1cc(C)c(C)cc1C |
| InChI | InChI=1S/C10H14.2C2H6.CH4/c1-7-5-9(3)10(4)6-8(7)2;2*1-2;/h5-6H,1-4H3;2*1-2H3;1H4 |
| InChIKey | UZJQJDYSFCHUKN-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.40 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |