C18H34 — CID 166473604
ethane;2-methylprop-1-ene;1,2,4,5-tetramethylbenzene (PubChem CID 166473604) has the molecular formula C18H34 and a molecular weight of 250.47 g/mol. Its IUPAC name is ethane;2-methylprop-1-ene;1,2,4,5-tetramethylbenzene.
| Compound Name | ethane;2-methylprop-1-ene;1,2,4,5-tetramethylbenzene |
|---|---|
| PubChem CID | 166473604 |
| Molecular Formula | C18H34 |
| Molecular Weight | 250.47 g/mol |
| Exact Mass | 250.27 |
| IUPAC Name | ethane;2-methylprop-1-ene;1,2,4,5-tetramethylbenzene |
| SMILES | C=C(C)C.CC.CC.Cc1cc(C)c(C)cc1C |
| InChI | InChI=1S/C10H14.C4H8.2C2H6/c1-7-5-9(3)10(4)6-8(7)2;1-4(2)3;2*1-2/h5-6H,1-4H3;1H2,2-3H3;2*1-2H3 |
| InChIKey | LEGJTLBYGLKTRR-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.47 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|