C13H21N — CID 177043564
2,4-dimethyl-5-prop-1-en-2-ylaniline;ethane (PubChem CID 177043564) has the molecular formula C13H21N and a molecular weight of 191.32 g/mol. Its IUPAC name is 2,4-dimethyl-5-prop-1-en-2-ylaniline;ethane.
| Compound Name | 2,4-dimethyl-5-prop-1-en-2-ylaniline;ethane |
|---|---|
| PubChem CID | 177043564 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | 2,4-dimethyl-5-prop-1-en-2-ylaniline;ethane |
| SMILES | C=C(C)c1cc(N)c(C)cc1C.CC |
| InChI | InChI=1S/C11H15N.C2H6/c1-7(2)10-6-11(12)9(4)5-8(10)3;1-2/h5-6H,1,12H2,2-4H3;1-2H3 |
| InChIKey | XBZYPCMCFOFAKE-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|