C11H15N — CID 134277556
1-(2,4,5-trimethylphenyl)ethenamine (PubChem CID 134277556) has the molecular formula C11H15N and a molecular weight of 161.25 g/mol. Its IUPAC name is 1-(2,4,5-trimethylphenyl)ethenamine.
| Compound Name | 1-(2,4,5-trimethylphenyl)ethenamine |
|---|---|
| PubChem CID | 134277556 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | 1-(2,4,5-trimethylphenyl)ethenamine |
| SMILES | C=C(N)c1cc(C)c(C)cc1C |
| InChI | InChI=1S/C11H15N/c1-7-5-9(3)11(10(4)12)6-8(7)2/h5-6H,4,12H2,1-3H3 |
| InChIKey | UERMDGRNBJSMHH-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |