About 1-hex-1-en-2-yl-2,4,5-trimethylbenzene
1-hex-1-en-2-yl-2,4,5-trimethylbenzene (PubChem CID 142349579) has the molecular formula C15H22
and a molecular weight of 202.34 g/mol. Its IUPAC name is 1-hex-1-en-2-yl-2,4,5-trimethylbenzene.
Molecular Properties
| Compound Name | 1-hex-1-en-2-yl-2,4,5-trimethylbenzene |
| PubChem CID | 142349579 |
| Molecular Formula | C15H22 |
| Molecular Weight | 202.34 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | 1-hex-1-en-2-yl-2,4,5-trimethylbenzene |
| SMILES | C=C(CCCC)c1cc(C)c(C)cc1C |
| InChI | InChI=1S/C15H22/c1-6-7-8-11(2)15-10-13(4)12(3)9-14(15)5/h9-10H,2,6-8H2,1,3-5H3 |
| InChIKey | VSSSNGAXXVWZGT-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.34 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-hex-1-en-2-yl-2,4,5-trimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hex-1-en-2-yl-2,4,5-trimethylbenzene?
The IUPAC name of 1-hex-1-en-2-yl-2,4,5-trimethylbenzene (CID 142349579) is 1-hex-1-en-2-yl-2,4,5-trimethylbenzene.
What is the SMILES notation for 1-hex-1-en-2-yl-2,4,5-trimethylbenzene?
The canonical SMILES for 1-hex-1-en-2-yl-2,4,5-trimethylbenzene is C=C(CCCC)c1cc(C)c(C)cc1C.
What is the InChIKey of 1-hex-1-en-2-yl-2,4,5-trimethylbenzene?
The InChIKey is VSSSNGAXXVWZGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22/c1-6-7-8-11(2)15-10-13(4)12(3)9-14(15)5/h9-10H,2,6-8H2,1,3-5H3.
What are the key properties of 1-hex-1-en-2-yl-2,4,5-trimethylbenzene?
1-hex-1-en-2-yl-2,4,5-trimethylbenzene has a molecular weight of 202.34 g/mol, XLogP of 4.82, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hex-1-en-2-yl-2,4,5-trimethylbenzene is sourced from PubChem (CID 142349579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).