C15H22 — CID 142349579
1-hex-1-en-2-yl-2,4,5-trimethylbenzene (PubChem CID 142349579) has the molecular formula C15H22 and a molecular weight of 202.34 g/mol. Its IUPAC name is 1-hex-1-en-2-yl-2,4,5-trimethylbenzene.
| Compound Name | 1-hex-1-en-2-yl-2,4,5-trimethylbenzene |
|---|---|
| PubChem CID | 142349579 |
| Molecular Formula | C15H22 |
| Molecular Weight | 202.34 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | 1-hex-1-en-2-yl-2,4,5-trimethylbenzene |
| SMILES | C=C(CCCC)c1cc(C)c(C)cc1C |
| InChI | InChI=1S/C15H22/c1-6-7-8-11(2)15-10-13(4)12(3)9-14(15)5/h9-10H,2,6-8H2,1,3-5H3 |
| InChIKey | VSSSNGAXXVWZGT-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.34 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |