C27H36 — CID 91498311
1-[5-(3,4-dimethylphenyl)pent-1-en-2-yl]-4-hept-1-en-2-yl-2-methylbenzene (PubChem CID 91498311) has the molecular formula C27H36 and a molecular weight of 360.59 g/mol. Its IUPAC name is 1-[5-(3,4-dimethylphenyl)pent-1-en-2-yl]-4-hept-1-en-2-yl-2-methylbenzene.
| Compound Name | 1-[5-(3,4-dimethylphenyl)pent-1-en-2-yl]-4-hept-1-en-2-yl-2-methylbenzene |
|---|---|
| PubChem CID | 91498311 |
| Molecular Formula | C27H36 |
| Molecular Weight | 360.59 g/mol |
| Exact Mass | 360.28 |
| IUPAC Name | 1-[5-(3,4-dimethylphenyl)pent-1-en-2-yl]-4-hept-1-en-2-yl-2-methylbenzene |
| SMILES | C=C(CCCCC)c1ccc(C(=C)CCCc2ccc(C)c(C)c2)c(C)c1 |
| InChI | InChI=1S/C27H36/c1-7-8-9-11-21(3)26-16-17-27(24(6)19-26)22(4)12-10-13-25-15-14-20(2)23(5)18-25/h14-19H,3-4,7-13H2,1-2,5-6H3 |
| InChIKey | BDIXWJFQIZVWCY-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.59 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|