C20H29Br — CID 174705030
4-bromo-1,2-bis(hept-1-en-2-yl)benzene (PubChem CID 174705030) has the molecular formula C20H29Br and a molecular weight of 349.36 g/mol. Its IUPAC name is 4-bromo-1,2-bis(hept-1-en-2-yl)benzene.
| Compound Name | 4-bromo-1,2-bis(hept-1-en-2-yl)benzene |
|---|---|
| PubChem CID | 174705030 |
| Molecular Formula | C20H29Br |
| Molecular Weight | 349.36 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 4-bromo-1,2-bis(hept-1-en-2-yl)benzene |
| SMILES | C=C(CCCCC)c1ccc(Br)cc1C(=C)CCCCC |
| InChI | InChI=1S/C20H29Br/c1-5-7-9-11-16(3)19-14-13-18(21)15-20(19)17(4)12-10-8-6-2/h13-15H,3-12H2,1-2H3 |
| InChIKey | SPKMTEDBVZGMQY-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.36 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|